MCQOPTIONS
Saved Bookmarks
MCQOPTIONS
This section includes 58536 Mcqs, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 11001. |
The famous camel trading event is a part of this annual fair. |
| A. | Udaipur Mela |
| B. | Thar Mela |
| C. | Kumbh Mela. |
| D. | Pushkar Mela |
| Answer» E. | |
| 11002. |
The process of passing the settled water through the beds of granular material is termed as _______. |
| A. | Sedimentation |
| B. | filtration |
| C. | screening |
| D. | disinfection |
| Answer» C. screening | |
| 11003. |
Under the National Rural Drinking Water Program (NRDWP), how many liters of drinking water per person should be available to every rural person in the country less than 50 meters in their horizontal or vertical direction from their home premises or from their homes by 2022? |
| A. | 80 |
| B. | 100 |
| C. | 60 |
| D. | 70 |
| Answer» E. | |
| 11004. |
Select the most appropriate meaning of the underlined idiom in the given sentence.The ball missed the wicket by a whisker. |
| A. | by a small margin |
| B. | by using her hands |
| C. | by hitting the bat |
| D. | by a sudden fall |
| Answer» B. by using her hands | |
| 11005. |
Steel rails are welded by |
| A. | Gas welding |
| B. | Thermite welding |
| C. | Resistance welding |
| D. | Argon arc welding |
| Answer» C. Resistance welding | |
| 11006. |
The H. C. F. of two numbers is 11 and their L. C. M. is 7700. If one number is 308 then other number is |
| A. | 269 |
| B. | 285 |
| C. | 300 |
| D. | 275 |
| Answer» E. | |
| 11007. |
Side AB of a triangle ABC is 80 cm long, whose perimeter is 170 cm. If angle ABC = 60°, the shortest side of triangle ABC measures _______ cm. |
| A. | 17 |
| B. | 15 |
| C. | 25 |
| D. | 21 |
| Answer» B. 15 | |
| 11008. |
When is National Women's Day of India celebrated every year? |
| A. | 10 February |
| B. | 11 February |
| C. | 12 February |
| D. | 13 February |
| E. | 14 February |
| Answer» E. 14 February | |
| 11009. |
The maximum number of electrons that can be accommodated in a shell is indicated by the formula: |
| A. | 2n3 |
| B. | 2n-2 |
| C. | 2n |
| D. | 2n2 |
| Answer» E. | |
| 11010. |
What does the phrase 'educated guess' mean in the passage? |
| A. | a gut feeling guess made by scientists based on intuition and foreboding. |
| B. | a guess based on knowledge and experience which is likely to be correct. |
| C. | a wild guess which is not based on any statistical data. |
| D. | a guess made by educated people like seismologists which is always correct. |
| Answer» C. a wild guess which is not based on any statistical data. | |
| 11011. |
What is the primary function of Kisan Mitra in Madhya Pradesh? |
| A. | To work as agricultural labourer |
| B. | To guard the fields of the farmer |
| C. | To spread information regarding government schemes |
| D. | To carry farmer's produce to market |
| Answer» D. To carry farmer's produce to market | |
| 11012. |
The essential difference between rigid and flexible pavements is |
| A. | Distribution of load over sub-grade |
| B. | Distribution of load over sub-base |
| C. | Materials used |
| D. | Thickness of layers |
| Answer» B. Distribution of load over sub-base | |
| 11013. |
Read the following statements carefully:1.The Centre is to set up a high-level task force for agri reforms.2.The decision was made in the fifth meeting of the NITI Aayog governing council.3.The task force is for undertaking structural reforms in agriculture, including strengthening logistics, produce marketing, food processing as well as changes to the Essential Commodities Act.Which of the above statements is/are correct? |
| A. | Only 1 |
| B. | Only 1 and 2 |
| C. | Only 1 and 3 |
| D. | Only 2 and 3 |
| E. | All are correct |
| Answer» F. | |
| 11014. |
Which of the following statements is/are correct regarding emotional/social development in a child?I. Between ages 2 and 6 months, infants express feelings such as anger, sadness, surprise and fearII. Babies cannot express themselves in any way until the age of 1 yearIII. Toddlers usually enter another emotionally rocky time between the ages of 15 to 18 months |
| A. | Both II and III |
| B. | Both I and II |
| C. | I, II and III |
| D. | Both I and III |
| Answer» E. | |
| 11015. |
Twelve solid hemispheres of the same size are melted and recast to in a right circular cylinder of diameter 7 cm and height 28 cm. What is the radius of the hemispheres? |
| A. | 4.5 cm |
| B. | 3.5 cm |
| C. | 3 cm |
| D. | 3.8 cm |
| Answer» C. 3 cm | |
| 11016. |
Read the following statements carefully:1.The researchers from IIT Bombay and School of Architecture, Bhubaneswar have developed bio-bricks from agricultural waste.2.The product serves dual purposes of development of eco-friendly sustainable material and also waste management.3.The bricks are made from agro-waste like wheat straw, paddy straw, sugarcane bagasse and cotton plant.Which of the above statements is/are correct? |
| A. | Only 1 |
| B. | Only 1 and 2 |
| C. | Only 1 and 3 |
| D. | Only 2 and 3 |
| E. | All are correct |
| Answer» E. All are correct | |
| 11017. |
Select the correct option.Air pollution is especially dangerous for |
| A. | pedestrians, cylcists and bus drivers |
| B. | elderly, children and people with lung problems |
| C. | men and women above fifty |
| D. | doctors who deal with respiratory diseases |
| Answer» C. men and women above fifty | |
| 11018. |
Three dice are thrown simultaneously. What is the probability of getting a sum of 3? |
| A. | 1/36 |
| B. | 1/6 |
| C. | 1/216 |
| D. | 1/9 |
| Answer» D. 1/9 | |
| 11019. |
The average of 11 observations is 60. If the average of first six observations is 59 and that of last six observations is 62, then the value of sixth observation, is: |
| A. | 63 |
| B. | 64 |
| C. | 66 |
| D. | 68 |
| Answer» D. 68 | |
| 11020. |
The Hornbill Festival is celebrated in which state? |
| A. | Nagaland |
| B. | Assam |
| C. | Meghalaya |
| D. | Arunachal Pradesh |
| Answer» B. Assam | |
| 11021. |
Which of the following is NOT a Trade Barrier? |
| A. | Subsidies |
| B. | Embargo |
| C. | Export Security |
| D. | Tariff Barriers |
| Answer» D. Tariff Barriers | |
| 11022. |
To hold cutting tools like drills and reamers in the lathe machine ______ is used |
| A. | Head stock |
| B. | Cross slide |
| C. | Tool post |
| D. | Tail stock |
| Answer» E. | |
| 11023. |
The _____attribute of tag is used to control the distance between the data in a cell and the boundaries of the cell. |
| A. | Colspan |
| B. | Rowspan |
| C. | Cellpadding |
| D. | cellspacing |
| Answer» D. cellspacing | |
| 11024. |
What is revised number of the National Highways connecting Indore to Jaipur? |
| A. | 52 |
| B. | 47 |
| C. | 03 |
| D. | 46 |
| Answer» B. 47 | |
| 11025. |
Statements:(I) All teachers are experienced.(II) Some teachers are spinsters.Conclusions:(I) Some experienced are spinsters(II) Some spinsters are experienced. |
| A. | Only conclusion I or II follow |
| B. | Either conclusion I or II follow |
| C. | Both conclusion I and II follow |
| D. | Only conclusion I follows |
| Answer» D. Only conclusion I follows | |
| 11026. |
Select the word which means the same as the group of words given.Splendid and expensive-looking |
| A. | peculiar |
| B. | curious |
| C. | malicious |
| D. | sumptuous |
| Answer» E. | |
| 11027. |
What is the name of the app launched by the Union Ministry of Power to provide real time information sharing on power supply? |
| A. | URJA MITRA |
| B. | BHIM |
| C. | URJA |
| D. | UMANG |
| Answer» B. BHIM | |
| 11028. |
Select the most appropriate option to substitute the underlined segment in the given sentence. If there is no need to substitute it, select No improvement.Passengers are requested to go for a security check before they proceed to board the flight. |
| A. | are request to go for |
| B. | are requests to go for |
| C. | are requesting to go for |
| D. | No improvement |
| Answer» E. | |
| 11029. |
The chemical name of vinegar is |
| A. | Methanol |
| B. | Ethanol |
| C. | Acetic acid |
| D. | Ethyl acetate |
| E. | None of the above / More than one above |
| Answer» D. Ethyl acetate | |
| 11030. |
The rail route that connects Gurugram to _______ is one of the oldest and largest junction of Haryana. |
| A. | Sonipat |
| B. | Rewari |
| C. | Dadri |
| D. | Narwana |
| Answer» C. Dadri | |
| 11031. |
The bare ground between plants is covered with a layer of organic matter like straw. It helps to retain soil moisture’. Identify the process. |
| A. | Contour Building |
| B. | Soil Mixing |
| C. | Mulching |
| D. | Contour Ploughing |
| Answer» D. Contour Ploughing | |
| 11032. |
What is the reactive power of a 3-phase delta connected system having a line voltage of 200 V and line current of 80 A and the phase difference between the voltage and current is 36.87 degrees? |
| A. | 13.856 KW |
| B. | 16.62 KVAR |
| C. | 22.17 KW |
| D. | 27.71 KVAR |
| Answer» C. 22.17 KW | |
| 11033. |
The probability that a thermistor randomly picked up from a production unit is defective is 0.1. The probability that out of 10 thermistors randomly picked up, 3 are defective is |
| A. | 0.001 |
| B. | 0.057 |
| C. | 0.107 |
| D. | 0.3 |
| Answer» C. 0.107 | |
| 11034. |
Which of the following is the color preference of A? |
| A. | Red |
| B. | Yellow |
| C. | Either Red or Yellow |
| D. | Cannot be determined |
| Answer» C. Either Red or Yellow | |
| 11035. |
The wheel of a motor car makes 1000 revolutions in moving 440 m. The diameter (in meter) of the wheel is |
| A. | 0.34 |
| B. | 0.14 |
| C. | 0.44 |
| D. | 0.24 |
| Answer» C. 0.44 | |
| 11036. |
The largest state (in terms of area) in India is: |
| A. | Madhya Pradesh |
| B. | Andhra Pradesh |
| C. | Maharashtra |
| D. | Rajasthan |
| Answer» E. | |
| 11037. |
Select the option that is related to the third term in the same way as the second term is related to the first term.Greenland : Arctic Ocean : : England : __________ |
| A. | Pacific Ocean |
| B. | Arctic Ocean |
| C. | Atlantic Ocean |
| D. | Antarctic Ocean |
| Answer» D. Antarctic Ocean | |
| 11038. |
Which of the following is not a part of the non-plan expenditure of central government? |
| A. | Interest payment |
| B. | Grants to states |
| C. | Electrification |
| D. | Subsidy |
| Answer» D. Subsidy | |
| 11039. |
Which of the following pairs of vector and disease is/are correctly matched? VectorDisease1.AnophelesMalaria2.Aedes aegyptiChikungunya3.Tsetse flyFilariasis4.Bed bugsSleeping sickness Select the correct answer using the code given below: |
| A. | 1, 2 and 3 only |
| B. | 1 and 2 only |
| C. | 1 and 4 only |
| D. | 2 only |
| Answer» C. 1 and 4 only | |
| 11040. |
The Russian name of INS Vikramaditya is |
| A. | Admiral Groshkov |
| B. | Admiral Gorbachev |
| C. | Admiral Nakhimov |
| D. | Admiral Petr Bezobrazov |
| Answer» B. Admiral Gorbachev | |
| 11041. |
What percent of total number of units sold by companies A, B and D is equal to the number of units manufactured by company C? (correct to one decimal place) |
| A. | 33.3 |
| B. | 35.6 |
| C. | 40.9 |
| D. | 36.7 |
| Answer» E. | |
| 11042. |
Which of the following is NOT a metalloid? |
| A. | Carbon |
| B. | Silicon |
| C. | Boron |
| D. | Arsenic |
| Answer» B. Silicon | |
| 11043. |
Which of the following terms follows the trend of the given list?PQPQPQPQ, RQPQPQPQ, PSPQPQPQ, PQRQPQPQ, PQPSPQPQ, _______________. |
| A. | PQPQPSPQ |
| B. | PQPQRQPQ |
| C. | PQPQPQPQ |
| D. | RQPQPQPQ |
| Answer» C. PQPQPQPQ | |
| 11044. |
Which of the following has launched a 12-week paid 'Returnship Programme’ for technology professionals looking to restart their careers after a break? |
| A. | Accenture |
| B. | Tata Consultancy Services |
| C. | Wipro |
| D. | Cognizant Technology Solutions Corp |
| E. | HCL Technologies |
| Answer» E. HCL Technologies | |
| 11045. |
Where does River Tamsa also called as Toan originate? |
| A. | Shahpura |
| B. | Matkai Hills |
| C. | Hoshangabad |
| D. | Satna |
| Answer» E. | |
| 11046. |
Sachin’s income is 25% more than Dileep’s income. By how much percentage is Dileep’s income less than Sachin’s income ? |
| A. | 15% |
| B. | 20% |
| C. | 18% |
| D. | 22% |
| Answer» C. 18% | |
| 11047. |
The value of \(0.\overline{63} + 0.\overline{37}\) is |
| A. | 100 |
| B. | 1.0101 |
| C. | 101 |
| D. | None of the above |
| Answer» C. 101 | |
| 11048. |
The average of 5 consecutive numbers is 8. If previous 5 numbers are also included, then what will be the new average? |
| A. | 5 |
| B. | 5.5 |
| C. | 4.5 |
| D. | 6 |
| Answer» C. 4.5 | |
| 11049. |
The Abu Dhabi Judicial Department (ADJD) added ________ as the 3rd official language to be spoken in the city’s courts. |
| A. | French |
| B. | Hindi |
| C. | Spanish |
| D. | Mandarin |
| E. | German |
| Answer» C. Spanish | |
| 11050. |
What percentage of the numbers from 101 to 1000 have 9 in the unit's digit? |
| A. | 20% |
| B. | 15% |
| C. | 12% |
| D. | 10% |
| Answer» E. | |